C24H23FN4O3S2 — CID 55905431
N-(3-cyano-5-ethylthiophen-2-yl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide (PubChem CID 55905431) has the molecular formula C24H23FN4O3S2 and a molecular weight of 498.61 g/mol. Its IUPAC name is N-(3-cyano-5-ethylthiophen-2-yl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide.
| Compound Name | N-(3-cyano-5-ethylthiophen-2-yl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 55905431 |
| Molecular Formula | C24H23FN4O3S2 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-(3-cyano-5-ethylthiophen-2-yl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide |
| SMILES | CCc1cc(C#N)c(NC(=O)c2cccc(S(=O)(=O)N3CCN(c4ccc(F)cc4)CC3)c2)s1 |
| InChI | InChI=1S/C24H23FN4O3S2/c1-2-21-14-18(16-26)24(33-21)27-23(30)17-4-3-5-22(15-17)34(31,32)29-12-10-28(11-13-29)20-8-6-19(25)7-9-20/h3-9,14-15H,2,10-13H2,1H3,(H,27,30) |
| InChIKey | VKDOMBPSKYWCBJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |