C20H22N4O4S2 — CID 55905941
3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-cyano-5-ethylthiophen-2-yl)benzamide (PubChem CID 55905941) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-cyano-5-ethylthiophen-2-yl)benzamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-cyano-5-ethylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 55905941 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-cyano-5-ethylthiophen-2-yl)benzamide |
| SMILES | CCc1cc(C#N)c(NC(=O)c2cccc(S(=O)(=O)N3CCN(C(C)=O)CC3)c2)s1 |
| InChI | InChI=1S/C20H22N4O4S2/c1-3-17-11-16(13-21)20(29-17)22-19(26)15-5-4-6-18(12-15)30(27,28)24-9-7-23(8-10-24)14(2)25/h4-6,11-12H,3,7-10H2,1-2H3,(H,22,26) |
| InChIKey | XUUGMQYJEDGWIP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |