C20H23N3O5S — CID 19257253
3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-methoxyphenyl)benzamide (PubChem CID 19257253) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-methoxyphenyl)benzamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 19257253 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2cccc(S(=O)(=O)N3CCN(C(C)=O)CC3)c2)c1 |
| InChI | InChI=1S/C20H23N3O5S/c1-15(24)22-9-11-23(12-10-22)29(26,27)19-8-3-5-16(13-19)20(25)21-17-6-4-7-18(14-17)28-2/h3-8,13-14H,9-12H2,1-2H3,(H,21,25) |
| InChIKey | GARKJFFTRSUNSJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |