C21H26N4O6S2 — CID 19257272
3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(dimethylsulfamoyl)phenyl]benzamide (PubChem CID 19257272) has the molecular formula C21H26N4O6S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(dimethylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(dimethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 19257272 |
| Molecular Formula | C21H26N4O6S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(dimethylsulfamoyl)phenyl]benzamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)Nc3ccc(S(=O)(=O)N(C)C)cc3)c2)CC1 |
| InChI | InChI=1S/C21H26N4O6S2/c1-16(26)24-11-13-25(14-12-24)33(30,31)20-6-4-5-17(15-20)21(27)22-18-7-9-19(10-8-18)32(28,29)23(2)3/h4-10,15H,11-14H2,1-3H3,(H,22,27) |
| InChIKey | DGQPYZTVHVCYQF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |