C20H21F2N3O4S2 — CID 26499246
3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide (PubChem CID 26499246) has the molecular formula C20H21F2N3O4S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26499246 |
| Molecular Formula | C20H21F2N3O4S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[4-(difluoromethylsulfanyl)phenyl]benzamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)Nc3ccc(SC(F)F)cc3)c2)CC1 |
| InChI | InChI=1S/C20H21F2N3O4S2/c1-14(26)24-9-11-25(12-10-24)31(28,29)18-4-2-3-15(13-18)19(27)23-16-5-7-17(8-6-16)30-20(21)22/h2-8,13,20H,9-12H2,1H3,(H,23,27) |
| InChIKey | RRTYMUHHJMUWMX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |