C20H22F2N2O3S2 — CID 112759122
N-[4-(difluoromethylsulfanyl)phenyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 112759122) has the molecular formula C20H22F2N2O3S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 112759122 |
| Molecular Formula | C20H22F2N2O3S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1cccc(C(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C20H22F2N2O3S2/c1-14-5-2-3-12-24(14)29(26,27)18-7-4-6-15(13-18)19(25)23-16-8-10-17(11-9-16)28-20(21)22/h4,6-11,13-14,20H,2-3,5,12H2,1H3,(H,23,25) |
| InChIKey | ZBLSGUHBJUSWRU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |