C19H22FN3O5S2 — CID 55979789
N-(3-fluoro-5-sulfamoylphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 55979789) has the molecular formula C19H22FN3O5S2 and a molecular weight of 455.53 g/mol. Its IUPAC name is N-(3-fluoro-5-sulfamoylphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(3-fluoro-5-sulfamoylphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55979789 |
| Molecular Formula | C19H22FN3O5S2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-(3-fluoro-5-sulfamoylphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1cccc(C(=O)Nc2cc(F)cc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C19H22FN3O5S2/c1-13-5-2-3-8-23(13)30(27,28)17-7-4-6-14(9-17)19(24)22-16-10-15(20)11-18(12-16)29(21,25)26/h4,6-7,9-13H,2-3,5,8H2,1H3,(H,22,24)(H2,21,25,26) |
| InChIKey | FETWRDHJZIDKLA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |