C21H26N2O6S2 — CID 55383504
N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 55383504) has the molecular formula C21H26N2O6S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55383504 |
| Molecular Formula | C21H26N2O6S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2cccc(S(=O)(=O)N3CCCCC3C)c2)c1 |
| InChI | InChI=1S/C21H26N2O6S2/c1-3-30(26,27)17-10-11-20(24)19(14-17)22-21(25)16-8-6-9-18(13-16)31(28,29)23-12-5-4-7-15(23)2/h6,8-11,13-15,24H,3-5,7,12H2,1-2H3,(H,22,25) |
| InChIKey | WAWMPVGRLCMDOV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|