C22H27N3O7S — CID 26687870
3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 26687870) has the molecular formula C22H27N3O7S and a molecular weight of 477.54 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 26687870 |
| Molecular Formula | C22H27N3O7S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cccc(S(=O)(=O)N3CCN(C(C)=O)CC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N3O7S/c1-15(26)24-8-10-25(11-9-24)33(28,29)18-7-5-6-16(12-18)22(27)23-17-13-19(30-2)21(32-4)20(14-17)31-3/h5-7,12-14H,8-11H2,1-4H3,(H,23,27) |
| InChIKey | LEDLSVXHDSOQOW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |