C18H18F2N2O4S — CID 87031517
N-(3,5-difluoro-4-methoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 87031517) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is N-(3,5-difluoro-4-methoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3,5-difluoro-4-methoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 87031517 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(3,5-difluoro-4-methoxyphenyl)-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1c(F)cc(NC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)cc1F |
| InChI | InChI=1S/C18H18F2N2O4S/c1-26-17-15(19)10-13(11-16(17)20)21-18(23)12-5-4-6-14(9-12)27(24,25)22-7-2-3-8-22/h4-6,9-11H,2-3,7-8H2,1H3,(H,21,23) |
| InChIKey | UWSATSVHAJDWME-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |