C21H24N2O5S — CID 7733570
propan-2-yl 4-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate (PubChem CID 7733570) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is propan-2-yl 4-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate.
| Compound Name | propan-2-yl 4-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 7733570 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | propan-2-yl 4-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15(2)28-21(25)16-8-10-18(11-9-16)22-20(24)17-6-5-7-19(14-17)29(26,27)23-12-3-4-13-23/h5-11,14-15H,3-4,12-13H2,1-2H3,(H,22,24) |
| InChIKey | MQJVCTJACJLTSL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |