C19H23N3O5S2 — CID 100619897
3-(methylsulfamoyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 100619897) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-(methylsulfamoyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 3-(methylsulfamoyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 100619897 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-(methylsulfamoyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C19H23N3O5S2/c1-20-28(24,25)18-7-5-6-15(14-18)19(23)21-16-8-10-17(11-9-16)29(26,27)22-12-3-2-4-13-22/h5-11,14,20H,2-4,12-13H2,1H3,(H,21,23) |
| InChIKey | ULMDZIFRCZGPLQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |