C20H25N3O6S2 — CID 26848789
N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(methylsulfamoyl)benzamide (PubChem CID 26848789) has the molecular formula C20H25N3O6S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(methylsulfamoyl)benzamide.
| Compound Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26848789 |
| Molecular Formula | C20H25N3O6S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2OC)c1 |
| InChI | InChI=1S/C20H25N3O6S2/c1-21-30(25,26)16-8-6-7-15(13-16)20(24)22-18-14-17(9-10-19(18)29-2)31(27,28)23-11-4-3-5-12-23/h6-10,13-14,21H,3-5,11-12H2,1-2H3,(H,22,24) |
| InChIKey | UHJFQZUHZDGQEH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |