C21H26N2O7S — CID 99952849
3,4,5-trimethoxy-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 99952849) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 99952849 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O7S/c1-27-17-8-7-15(31(25,26)23-9-5-6-10-23)13-16(17)22-21(24)14-11-18(28-2)20(30-4)19(12-14)29-3/h7-8,11-13H,5-6,9-10H2,1-4H3,(H,22,24) |
| InChIKey | RFNLRQPCPTZQAE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |