C26H35N3O6S — CID 4850008
3,4,5-trimethoxy-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 4850008) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4850008 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2N2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H35N3O6S/c1-33-23-16-19(17-24(34-2)25(23)35-3)26(30)27-21-18-20(36(31,32)29-14-8-5-9-15-29)10-11-22(21)28-12-6-4-7-13-28/h10-11,16-18H,4-9,12-15H2,1-3H3,(H,27,30) |
| InChIKey | YNAUSFASESHQIJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |