C26H36N4O5S2 — CID 4986989
N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 4986989) has the molecular formula C26H36N4O5S2 and a molecular weight of 548.73 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4986989 |
| Molecular Formula | C26H36N4O5S2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCCC2)c(NC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C26H36N4O5S2/c1-3-29(4-2)36(32,33)23-13-14-25(28-15-6-5-7-16-28)24(20-23)27-26(31)21-11-10-12-22(19-21)37(34,35)30-17-8-9-18-30/h10-14,19-20H,3-9,15-18H2,1-2H3,(H,27,31) |
| InChIKey | DTFFTTRKMYOYJC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |