C27H31N3O7S — CID 17320426
3,4,5-trimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]benzamide (PubChem CID 17320426) has the molecular formula C27H31N3O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 17320426 |
| Molecular Formula | C27H31N3O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]benzamide |
| SMILES | COc1ccccc1N1CCN(S(=O)(=O)c2ccc(NC(=O)c3cc(OC)c(OC)c(OC)c3)cc2)CC1 |
| InChI | InChI=1S/C27H31N3O7S/c1-34-23-8-6-5-7-22(23)29-13-15-30(16-14-29)38(32,33)21-11-9-20(10-12-21)28-27(31)19-17-24(35-2)26(37-4)25(18-19)36-3/h5-12,17-18H,13-16H2,1-4H3,(H,28,31) |
| InChIKey | BNKIRHUILFIZLB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |