C22H28N2O6S — CID 17311736
3,4,5-trimethoxy-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzamide (PubChem CID 17311736) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 17311736 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(S(=O)(=O)N3CCCC(C)C3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H28N2O6S/c1-15-6-5-11-24(14-15)31(26,27)18-9-7-17(8-10-18)23-22(25)16-12-19(28-2)21(30-4)20(13-16)29-3/h7-10,12-13,15H,5-6,11,14H2,1-4H3,(H,23,25) |
| InChIKey | LCMTZHUBNHTSDG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |