C21H27N3O4S2 — CID 27109373
1-(3,4-dimethoxyphenyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]thiourea (PubChem CID 27109373) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 27109373 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCC[C@H](C)C3)cc2)cc1OC |
| InChI | InChI=1S/C21H27N3O4S2/c1-15-5-4-12-24(14-15)30(25,26)18-9-6-16(7-10-18)22-21(29)23-17-8-11-19(27-2)20(13-17)28-3/h6-11,13,15H,4-5,12,14H2,1-3H3,(H2,22,23,29)/t15-/m0/s1 |
| InChIKey | AHNAXXKQMXMEGG-HNNXBMFYSA-N |
| XLogP | 3.93 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|