C19H23N3O4S2 — CID 1296321
1-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 1296321) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 1296321 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1OC |
| InChI | InChI=1S/C19H23N3O4S2/c1-25-17-10-7-15(13-18(17)26-2)21-19(27)20-14-5-8-16(9-6-14)28(23,24)22-11-3-4-12-22/h5-10,13H,3-4,11-12H2,1-2H3,(H2,20,21,27) |
| InChIKey | QVPSJDFJJOUPKP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|