C18H21N3O3S2 — CID 19680447
1-(2-methoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 19680447) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 19680447 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-24-17-7-3-2-6-16(17)20-18(25)19-14-8-10-15(11-9-14)26(22,23)21-12-4-5-13-21/h2-3,6-11H,4-5,12-13H2,1H3,(H2,19,20,25) |
| InChIKey | XSONJACFQFWOPX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|