C21H23N3O4S2 — CID 4650029
3-(2-methoxyphenyl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 4650029) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-(2-methoxyphenyl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4650029 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | COc1ccccc1C=CC(=O)NC(=S)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H23N3O4S2/c1-28-19-7-3-2-6-16(19)8-13-20(25)23-21(29)22-17-9-11-18(12-10-17)30(26,27)24-14-4-5-15-24/h2-3,6-13H,4-5,14-15H2,1H3,(H2,22,23,25,29) |
| InChIKey | MIOJMJHNMUCOJJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|