C25H26N4O3S2 — CID 6211802
(E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 6211802) has the molecular formula C25H26N4O3S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 6211802 |
| Molecular Formula | C25H26N4O3S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (E)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=S)NC(=O)/C=C/c3cccc4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C25H26N4O3S2/c1-28-15-17-29(18-16-28)34(31,32)22-12-10-21(11-13-22)26-25(33)27-24(30)14-9-20-7-4-6-19-5-2-3-8-23(19)20/h2-14H,15-18H2,1H3,(H2,26,27,30,33)/b14-9+ |
| InChIKey | PTRNWGWUTKXHOH-NTEUORMPSA-N |
| XLogP | 3.30 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|