C22H18N2O3S — CID 6122361
methyl 4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]benzoate (PubChem CID 6122361) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is methyl 4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 6122361 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=O)/C=C/c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c1-27-21(26)17-9-12-18(13-10-17)23-22(28)24-20(25)14-11-16-7-4-6-15-5-2-3-8-19(15)16/h2-14H,1H3,(H2,23,24,25,28)/b14-11+ |
| InChIKey | BBQWQYVNBQXSKL-SDNWHVSQSA-N |
| XLogP | 4.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|