C26H29N3O3S2 — CID 6233403
(E)-N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 6233403) has the molecular formula C26H29N3O3S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is (E)-N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 6233403 |
| Molecular Formula | C26H29N3O3S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (E)-N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=S)NC(=O)/C=C/c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H29N3O3S2/c1-3-18-29(19-4-2)34(31,32)23-15-13-22(14-16-23)27-26(33)28-25(30)17-12-21-10-7-9-20-8-5-6-11-24(20)21/h5-17H,3-4,18-19H2,1-2H3,(H2,27,28,30,33)/b17-12+ |
| InChIKey | YULRHGFBUCASRQ-SFQUDFHCSA-N |
| XLogP | 5.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|