C29H25N3O2S — CID 43888019
4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide (PubChem CID 43888019) has the molecular formula C29H25N3O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is 4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 43888019 |
| Molecular Formula | C29H25N3O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC(=S)NC(=O)/C=C/c2cccc3ccccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H25N3O2S/c1-20(21-8-3-2-4-9-21)30-28(34)24-14-17-25(18-15-24)31-29(35)32-27(33)19-16-23-12-7-11-22-10-5-6-13-26(22)23/h2-20H,1H3,(H,30,34)(H2,31,32,33,35)/b19-16+ |
| InChIKey | QMIFPZQQVXFRHR-KNTRCKAVSA-N |
| XLogP | 5.86 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|