C27H21N3O2S — CID 6122169
2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-phenylbenzamide (PubChem CID 6122169) has the molecular formula C27H21N3O2S and a molecular weight of 451.55 g/mol. Its IUPAC name is 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-phenylbenzamide.
| Compound Name | 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 6122169 |
| Molecular Formula | C27H21N3O2S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-N-phenylbenzamide |
| SMILES | O=C(/C=C/c1cccc2ccccc12)NC(=S)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H21N3O2S/c31-25(18-17-20-11-8-10-19-9-4-5-14-22(19)20)30-27(33)29-24-16-7-6-15-23(24)26(32)28-21-12-2-1-3-13-21/h1-18H,(H,28,32)(H2,29,30,31,33)/b18-17+ |
| InChIKey | MVKXGYFBTZOGMF-ISLYRVAYSA-N |
| XLogP | 5.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|