C22H20N2OS — CID 3576339
N-[(2,3-dimethylphenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 3576339) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | N-[(2,3-dimethylphenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 3576339 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[(2,3-dimethylphenyl)carbamothioyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | Cc1cccc(NC(=S)NC(=O)C=Cc2cccc3ccccc23)c1C |
| InChI | InChI=1S/C22H20N2OS/c1-15-7-5-12-20(16(15)2)23-22(26)24-21(25)14-13-18-10-6-9-17-8-3-4-11-19(17)18/h3-14H,1-2H3,(H2,23,24,25,26) |
| InChIKey | UDHTWJVKFBQPAC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|