C21H20N2OS — CID 4778596
N-[(2,3-dimethylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide (PubChem CID 4778596) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(2,3-dimethylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 4778596 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[(2,3-dimethylphenyl)carbamothioyl]-2-naphthalen-1-ylacetamide |
| SMILES | Cc1cccc(NC(=S)NC(=O)Cc2cccc3ccccc23)c1C |
| InChI | InChI=1S/C21H20N2OS/c1-14-7-5-12-19(15(14)2)22-21(25)23-20(24)13-17-10-6-9-16-8-3-4-11-18(16)17/h3-12H,13H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | UGBGDBTZDFINEK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|