C20H19NO — CID 1228165
N-(2,3-dimethylphenyl)-2-naphthalen-1-ylacetamide (PubChem CID 1228165) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 1228165 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-naphthalen-1-ylacetamide |
| SMILES | Cc1cccc(NC(=O)Cc2cccc3ccccc23)c1C |
| InChI | InChI=1S/C20H19NO/c1-14-7-5-12-19(15(14)2)21-20(22)13-17-10-6-9-16-8-3-4-11-18(16)17/h3-12H,13H2,1-2H3,(H,21,22) |
| InChIKey | LGMHQJUAXYUIKT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |