C17H20N2O — CID 81317941
2-[2-(aminomethyl)phenyl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 81317941) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[2-(aminomethyl)phenyl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[2-(aminomethyl)phenyl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 81317941 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-[2-(aminomethyl)phenyl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2ccccc2CN)c1C |
| InChI | InChI=1S/C17H20N2O/c1-12-6-5-9-16(13(12)2)19-17(20)10-14-7-3-4-8-15(14)11-18/h3-9H,10-11,18H2,1-2H3,(H,19,20) |
| InChIKey | SCDMILDCSBAIDA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |