C10H13NO2 — CID 16769655
N-(2,3-dimethylphenyl)-2-hydroxyacetamide (PubChem CID 16769655) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-hydroxyacetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 16769655 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-hydroxyacetamide |
| SMILES | Cc1cccc(NC(=O)CO)c1C |
| InChI | InChI=1S/C10H13NO2/c1-7-4-3-5-9(8(7)2)11-10(13)6-12/h3-5,12H,6H2,1-2H3,(H,11,13) |
| InChIKey | BYYRWPBLPWFMQM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |