C9H10BrNO2 — CID 123237382
N-(3-bromo-2-methylphenyl)-2-hydroxyacetamide (PubChem CID 123237382) has the molecular formula C9H10BrNO2 and a molecular weight of 244.09 g/mol. Its IUPAC name is N-(3-bromo-2-methylphenyl)-2-hydroxyacetamide.
| Compound Name | N-(3-bromo-2-methylphenyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 123237382 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | N-(3-bromo-2-methylphenyl)-2-hydroxyacetamide |
| SMILES | Cc1c(Br)cccc1NC(=O)CO |
| InChI | InChI=1S/C9H10BrNO2/c1-6-7(10)3-2-4-8(6)11-9(13)5-12/h2-4,12H,5H2,1H3,(H,11,13) |
| InChIKey | CBYFWYZERXXPQT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |