C12H15NO3 — CID 14278404
methyl 3-(2,3-dimethylanilino)-3-oxopropanoate (PubChem CID 14278404) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl 3-(2,3-dimethylanilino)-3-oxopropanoate.
| Compound Name | methyl 3-(2,3-dimethylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 14278404 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | methyl 3-(2,3-dimethylanilino)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C12H15NO3/c1-8-5-4-6-10(9(8)2)13-11(14)7-12(15)16-3/h4-6H,7H2,1-3H3,(H,13,14) |
| InChIKey | MVUWNDZJULUXKY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|