C18H22N2O2 — CID 9099909
N-(2,3-dimethylphenyl)-2-(2-methoxy-5-methylanilino)acetamide (PubChem CID 9099909) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(2-methoxy-5-methylanilino)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(2-methoxy-5-methylanilino)acetamide |
|---|---|
| PubChem CID | 9099909 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(2-methoxy-5-methylanilino)acetamide |
| SMILES | COc1ccc(C)cc1NCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C18H22N2O2/c1-12-8-9-17(22-4)16(10-12)19-11-18(21)20-15-7-5-6-13(2)14(15)3/h5-10,19H,11H2,1-4H3,(H,20,21) |
| InChIKey | YTTQFYZNLLCBPT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |