C18H22N4O2S — CID 8617902
1-(2,3-dimethylphenyl)-3-[[2-(2-methoxyanilino)acetyl]amino]thiourea (PubChem CID 8617902) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[[2-(2-methoxyanilino)acetyl]amino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[[2-(2-methoxyanilino)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8617902 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[[2-(2-methoxyanilino)acetyl]amino]thiourea |
| SMILES | COc1ccccc1NCC(=O)NNC(=S)Nc1cccc(C)c1C |
| InChI | InChI=1S/C18H22N4O2S/c1-12-7-6-9-14(13(12)2)20-18(25)22-21-17(23)11-19-15-8-4-5-10-16(15)24-3/h4-10,19H,11H2,1-3H3,(H,21,23)(H2,20,22,25) |
| InChIKey | VNMRSPSQICSTEU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|