C17H20N4O3S — CID 8617883
1-[[2-(2-methoxyanilino)acetyl]amino]-3-(3-methoxyphenyl)thiourea (PubChem CID 8617883) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-[[2-(2-methoxyanilino)acetyl]amino]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[[2-(2-methoxyanilino)acetyl]amino]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8617883 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[[2-(2-methoxyanilino)acetyl]amino]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)NNC(=O)CNc2ccccc2OC)c1 |
| InChI | InChI=1S/C17H20N4O3S/c1-23-13-7-5-6-12(10-13)19-17(25)21-20-16(22)11-18-14-8-3-4-9-15(14)24-2/h3-10,18H,11H2,1-2H3,(H,20,22)(H2,19,21,25) |
| InChIKey | URGJZFRTWWOEIJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|