C11H15N3O3S — CID 2823947
ethyl N-[(3-methoxyphenyl)carbamothioylamino]carbamate (PubChem CID 2823947) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is ethyl N-[(3-methoxyphenyl)carbamothioylamino]carbamate.
| Compound Name | ethyl N-[(3-methoxyphenyl)carbamothioylamino]carbamate |
|---|---|
| PubChem CID | 2823947 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | ethyl N-[(3-methoxyphenyl)carbamothioylamino]carbamate |
| SMILES | CCOC(=O)NNC(=S)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C11H15N3O3S/c1-3-17-11(15)14-13-10(18)12-8-5-4-6-9(7-8)16-2/h4-7H,3H2,1-2H3,(H,14,15)(H2,12,13,18) |
| InChIKey | HYBFIIMONKYMNI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|