C19H17N3O3S — CID 8000990
1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(3-methoxyphenyl)thiourea (PubChem CID 8000990) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8000990 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)NNC(=O)c2cc3ccccc3cc2O)c1 |
| InChI | InChI=1S/C19H17N3O3S/c1-25-15-8-4-7-14(11-15)20-19(26)22-21-18(24)16-9-12-5-2-3-6-13(12)10-17(16)23/h2-11,23H,1H3,(H,21,24)(H2,20,22,26) |
| InChIKey | ONZDYNZJLQODSN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|