C19H16N2O4 — CID 806093
3-hydroxy-N'-(4-methoxybenzoyl)naphthalene-2-carbohydrazide (PubChem CID 806093) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-hydroxy-N'-(4-methoxybenzoyl)naphthalene-2-carbohydrazide.
| Compound Name | 3-hydroxy-N'-(4-methoxybenzoyl)naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 806093 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-hydroxy-N'-(4-methoxybenzoyl)naphthalene-2-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cc3ccccc3cc2O)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-25-15-8-6-12(7-9-15)18(23)20-21-19(24)16-10-13-4-2-3-5-14(13)11-17(16)22/h2-11,22H,1H3,(H,20,23)(H,21,24) |
| InChIKey | YZUIHHHZXFRZTK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|