C19H14N2O5 — CID 969323
2-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]benzoic acid (PubChem CID 969323) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 2-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]benzoic acid.
| Compound Name | 2-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 969323 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[[(3-hydroxynaphthalene-2-carbonyl)amino]carbamoyl]benzoic acid |
| SMILES | O=C(NNC(=O)c1ccccc1C(=O)O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C19H14N2O5/c22-16-10-12-6-2-1-5-11(12)9-15(16)18(24)21-20-17(23)13-7-3-4-8-14(13)19(25)26/h1-10,22H,(H,20,23)(H,21,24)(H,25,26) |
| InChIKey | BKKNRNLYIGKPAY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|