C15H18N2O2 — CID 118418396
N'-butyl-3-hydroxynaphthalene-2-carbohydrazide (PubChem CID 118418396) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N'-butyl-3-hydroxynaphthalene-2-carbohydrazide.
| Compound Name | N'-butyl-3-hydroxynaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 118418396 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N'-butyl-3-hydroxynaphthalene-2-carbohydrazide |
| SMILES | CCCCNNC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C15H18N2O2/c1-2-3-8-16-17-15(19)13-9-11-6-4-5-7-12(11)10-14(13)18/h4-7,9-10,16,18H,2-3,8H2,1H3,(H,17,19) |
| InChIKey | HDCTYQNICGZJEH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|