C28H28N2O4 — CID 3119117
3-hydroxy-N-[6-[(3-hydroxynaphthalene-2-carbonyl)amino]hexyl]naphthalene-2-carboxamide (PubChem CID 3119117) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-hydroxy-N-[6-[(3-hydroxynaphthalene-2-carbonyl)amino]hexyl]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-[6-[(3-hydroxynaphthalene-2-carbonyl)amino]hexyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3119117 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-hydroxy-N-[6-[(3-hydroxynaphthalene-2-carbonyl)amino]hexyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCCCCCCNC(=O)c1cc2ccccc2cc1O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C28H28N2O4/c31-25-17-21-11-5-3-9-19(21)15-23(25)27(33)29-13-7-1-2-8-14-30-28(34)24-16-20-10-4-6-12-22(20)18-26(24)32/h3-6,9-12,15-18,31-32H,1-2,7-8,13-14H2,(H,29,33)(H,30,34) |
| InChIKey | GJRIECLFNQNSCE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|