C17H16N2O2 — CID 103722595
3-hydroxy-N-(2-pyrrol-1-ylethyl)naphthalene-2-carboxamide (PubChem CID 103722595) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-hydroxy-N-(2-pyrrol-1-ylethyl)naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-(2-pyrrol-1-ylethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 103722595 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-hydroxy-N-(2-pyrrol-1-ylethyl)naphthalene-2-carboxamide |
| SMILES | O=C(NCCn1cccc1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C17H16N2O2/c20-16-12-14-6-2-1-5-13(14)11-15(16)17(21)18-7-10-19-8-3-4-9-19/h1-6,8-9,11-12,20H,7,10H2,(H,18,21) |
| InChIKey | GMHKJBAWPJQAJL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |