C18H23NO2 — CID 115325898
3-hydroxy-N-(5-methylhexyl)naphthalene-2-carboxamide (PubChem CID 115325898) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-hydroxy-N-(5-methylhexyl)naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-(5-methylhexyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 115325898 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-hydroxy-N-(5-methylhexyl)naphthalene-2-carboxamide |
| SMILES | CC(C)CCCCNC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H23NO2/c1-13(2)7-5-6-10-19-18(21)16-11-14-8-3-4-9-15(14)12-17(16)20/h3-4,8-9,11-13,20H,5-7,10H2,1-2H3,(H,19,21) |
| InChIKey | VMZVQGANXRWMFC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|