C11H12N2O6S — CID 160733684
3-hydroxynaphthalene-2-carbohydrazide;sulfuric acid (PubChem CID 160733684) has the molecular formula C11H12N2O6S and a molecular weight of 300.29 g/mol. Its IUPAC name is 3-hydroxynaphthalene-2-carbohydrazide;sulfuric acid.
| Compound Name | 3-hydroxynaphthalene-2-carbohydrazide;sulfuric acid |
|---|---|
| PubChem CID | 160733684 |
| Molecular Formula | C11H12N2O6S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-hydroxynaphthalene-2-carbohydrazide;sulfuric acid |
| SMILES | NNC(=O)c1cc2ccccc2cc1O.O=S(=O)(O)O |
| InChI | InChI=1S/C11H10N2O2.H2O4S/c12-13-11(15)9-5-7-3-1-2-4-8(7)6-10(9)14;1-5(2,3)4/h1-6,14H,12H2,(H,13,15);(H2,1,2,3,4) |
| InChIKey | RURCSLUAIAQXOQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|