C12H12N4O3 — CID 23149584
3-hydroxynaphthalene-2,7-dicarbohydrazide (PubChem CID 23149584) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-hydroxynaphthalene-2,7-dicarbohydrazide.
| Compound Name | 3-hydroxynaphthalene-2,7-dicarbohydrazide |
|---|---|
| PubChem CID | 23149584 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-hydroxynaphthalene-2,7-dicarbohydrazide |
| SMILES | NNC(=O)c1ccc2cc(O)c(C(=O)NN)cc2c1 |
| InChI | InChI=1S/C12H12N4O3/c13-15-11(18)7-2-1-6-5-10(17)9(12(19)16-14)4-8(6)3-7/h1-5,17H,13-14H2,(H,15,18)(H,16,19) |
| InChIKey | IGXQMEYKVRLDGN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|