C8H10N4O3 — CID 13149470
4-hydroxybenzene-1,3-dicarbohydrazide (PubChem CID 13149470) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 4-hydroxybenzene-1,3-dicarbohydrazide.
| Compound Name | 4-hydroxybenzene-1,3-dicarbohydrazide |
|---|---|
| PubChem CID | 13149470 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-hydroxybenzene-1,3-dicarbohydrazide |
| SMILES | NNC(=O)c1ccc(O)c(C(=O)NN)c1 |
| InChI | InChI=1S/C8H10N4O3/c9-11-7(14)4-1-2-6(13)5(3-4)8(15)12-10/h1-3,13H,9-10H2,(H,11,14)(H,12,15) |
| InChIKey | LIWPKBXACNBUMI-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|