C27H18O9 — CID 172840396
[3-[3-(3,4-dihydroxybenzoyl)-4-hydroxybenzoyl]-4-hydroxyphenyl]-(3,4-dihydroxyphenyl)methanone (PubChem CID 172840396) has the molecular formula C27H18O9 and a molecular weight of 486.43 g/mol. Its IUPAC name is [3-[3-(3,4-dihydroxybenzoyl)-4-hydroxybenzoyl]-4-hydroxyphenyl]-(3,4-dihydroxyphenyl)methanone.
| Compound Name | [3-[3-(3,4-dihydroxybenzoyl)-4-hydroxybenzoyl]-4-hydroxyphenyl]-(3,4-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 172840396 |
| Molecular Formula | C27H18O9 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | [3-[3-(3,4-dihydroxybenzoyl)-4-hydroxybenzoyl]-4-hydroxyphenyl]-(3,4-dihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)c(O)c1)c1ccc(O)c(C(=O)c2ccc(O)c(C(=O)c3ccc(O)c(O)c3)c2)c1 |
| InChI | InChI=1S/C27H18O9/c28-19-5-1-13(25(34)15-3-7-21(30)23(32)11-15)9-17(19)26(35)14-2-6-20(29)18(10-14)27(36)16-4-8-22(31)24(33)12-16/h1-12,28-33H |
| InChIKey | WSFSSOAPALRJEH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|