C14H10O7 — CID 101344973
2-(3,4-dihydroxybenzoyl)-4,6-dihydroxybenzoic acid (PubChem CID 101344973) has the molecular formula C14H10O7 and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-(3,4-dihydroxybenzoyl)-4,6-dihydroxybenzoic acid.
| Compound Name | 2-(3,4-dihydroxybenzoyl)-4,6-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 101344973 |
| Molecular Formula | C14H10O7 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(3,4-dihydroxybenzoyl)-4,6-dihydroxybenzoic acid |
| SMILES | O=C(c1ccc(O)c(O)c1)c1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C14H10O7/c15-7-4-8(12(14(20)21)11(18)5-7)13(19)6-1-2-9(16)10(17)3-6/h1-5,15-18H,(H,20,21) |
| InChIKey | XHIWAMWVGHRXAE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|